cas: 29242-87-3 — see every product listed under this CAS number, including other names
2,4-Dichloronaphthalen-1-amine 97% (CAS 29242-87-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A258153-100g |
| cas | 29242-87-3 |
| size | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 2267.19 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 10g | 337.00 Pln | |
| Ambeed | 25g | 620.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A258153 |
2,4-dichloronaphthalen-1-amine (CAS 29242-87-3) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 2,4-dichloronaphthalen-1-amine. InChIKey: OZFIRPDNZCDFMO-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 2,4-dichloronaphthalen-1-amine |
| InChIKey | OZFIRPDNZCDFMO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2N)Cl)Cl |
Computed by PubChem (NCBI)