cas: 123344-02-5 — see every product listed under this CAS number, including other names
2,4-Difluoro-5-nitroaniline 98% (CAS 123344-02-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A285654-100mg |
| cas | 123344-02-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 10g | 542.81 Pln | |
| Ambeed | 25g | 1093.50 Pln | |
| Ambeed | 100g | 3630.00 Pln | |
| Ambeed | 500g | 16056.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A285654 |
2,4-difluoro-5-nitroaniline (CAS 123344-02-5) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 2,4-difluoro-5-nitroaniline. InChIKey: LYWNQLCSOFZLOR-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,4-difluoro-5-nitroaniline |
| InChIKey | LYWNQLCSOFZLOR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])F)F)N |
Computed by PubChem (NCBI)