cas: 189283-54-3 — see every product listed under this CAS number, including other names
2,4-Difluoro-6-hydroxybenzoic acid, 95% (CAS 189283-54-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037217-250MG |
| cas | 189283-54-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1299.56 Pln | |
| Fluorochem | 1g | 3767.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,4-difluoro-6-hydroxybenzoic acid (CAS 189283-54-3) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 2,4-difluoro-6-hydroxybenzoic acid. InChIKey: DHJRFSOFNFQKJE-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,4-difluoro-6-hydroxybenzoic acid |
| InChIKey | DHJRFSOFNFQKJE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)C(=O)O)F)F |
Computed by PubChem (NCBI)