cas: 605-67-4 — see every product listed under this CAS number, including other names
2,4-Dimethylbenzo(h)quinoline, 95% (CAS 605-67-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A992045-1g |
| cas | 605-67-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 23597.14 Pln | |
| AmBeed | 250mg | 9463.93 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-dimethylbenzo[h]quinoline (CAS 605-67-4) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 2,4-dimethylbenzo[h]quinoline. InChIKey: VPSXZUORXQYBAT-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 2,4-dimethylbenzo[h]quinoline |
| InChIKey | VPSXZUORXQYBAT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=CC3=CC=CC=C32)C |
Computed by PubChem (NCBI)