cas: 610-30-0 — see every product listed under this CAS number, including other names
2,4-Dinitrobenzoic Acid, 98%, 98% (CAS 610-30-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FUZ-1g |
| cas | 610-30-0 |
| size | 1g |
| availability | 835.78g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 25g | 477.20 Pln | |
| Chemat | 100g | 1509.20 Pln | |
| Chemat | 500g | 6888.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4-dinitrobenzoic acid (CAS 610-30-0) is a chemical compound with the molecular formula C7H4N2O6 and a molecular weight of 212.12 g/mol. IUPAC name: 2,4-dinitrobenzoic acid. InChIKey: ZIIGSRYPZWDGBT-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O6 |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | 2,4-dinitrobenzoic acid |
| InChIKey | ZIIGSRYPZWDGBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)