CAS 528-45-0 appears in our catalog under these names: 3,4-Dinitrobenzoic acid, 98%, 3,4–Dinitrobenzoic Acid, 3,4-Dinitrobenzoic acid, 98+% , 3,4-Dinitrobenzoic acid, 3,4-Dinitrobenzoic Acid, >98.0%(GC)(T). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 25g, 5g, 1g, 100g, 0,05kg, 0,025kg, 0,1kg, 0,25kg.
3,4-dinitrobenzoic acid (CAS 528-45-0) is a chemical compound with the molecular formula C7H4N2O6 and a molecular weight of 212.12 g/mol. IUPAC name: 3,4-dinitrobenzoic acid. InChIKey: OMVRRHJJQILIJX-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O6 |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | 3,4-dinitrobenzoic acid |
| InChIKey | OMVRRHJJQILIJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)