CAS 610-28-6 is the registry number for 2,5–Dinitrobenzoic acid. Offered by: GLPBio. Available pack sizes: 1g.
2,5-dinitrobenzoic acid (CAS 610-28-6) is a chemical compound with the molecular formula C7H4N2O6 and a molecular weight of 212.12 g/mol. IUPAC name: 2,5-dinitrobenzoic acid. InChIKey: YKMDNKRCCODWMG-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O6 |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | 2,5-dinitrobenzoic acid |
| InChIKey | YKMDNKRCCODWMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)