CAS 603-12-3 appears in our catalog under these names: 2,6-Dinitrobenzoic Acid, 2,6-Dinitrobenzoic Acid, >95%, >95%, 2,6-Dinitrobenzoic acid, >95%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2,6-dinitrobenzoic acid (CAS 603-12-3) is a chemical compound with the molecular formula C7H4N2O6 and a molecular weight of 212.12 g/mol. IUPAC name: 2,6-dinitrobenzoic acid. InChIKey: HKKWSIQQYJTJLW-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O6 |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | 2,6-dinitrobenzoic acid |
| InChIKey | HKKWSIQQYJTJLW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)