CAS 610-30-0 appears in our catalog under these names: 2,4-Dinitrobenzoic acid, 95%, 2,4-Dinitrobenzoic acid, 2,4–Dinitrobenzoic acid, 2,4-Dinitrobenzoic acid, 98% , 2,4-DINITROBENZOIC ACID, 96%. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 5g, 250mg, 100g, 25g, 10g, 50g, 500g.
2,4-dinitrobenzoic acid (CAS 610-30-0) is a chemical compound with the molecular formula C7H4N2O6 and a molecular weight of 212.12 g/mol. IUPAC name: 2,4-dinitrobenzoic acid. InChIKey: ZIIGSRYPZWDGBT-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O6 |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | 2,4-dinitrobenzoic acid |
| InChIKey | ZIIGSRYPZWDGBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)