CAS 7748-59-6 appears in our catalog under these names: 1,2-Dinitro-4,5-methylenedioxybenzene, >95% (HPLC), 5,6-Dinitro-1,3-benzodioxole, 95%, 95%, 5,6-dinitro-1,3-benzodioxole. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 1g.
5,6-dinitro-1,3-benzodioxole (CAS 7748-59-6) is a chemical compound with the molecular formula C7H4N2O6 and a molecular weight of 212.12 g/mol. IUPAC name: 5,6-dinitro-1,3-benzodioxole. InChIKey: KAKKXKBQUBETST-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O6 |
|---|---|
| Molecular weight | 212.12 g/mol |
| IUPAC name | 5,6-dinitro-1,3-benzodioxole |
| InChIKey | KAKKXKBQUBETST-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)