cas: 1158259-09-6 — see every product listed under this CAS number, including other names
2,5-Diaminobenzoic acid dihydrochloride (CAS 1158259-09-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619791-1G |
| cas | 1158259-09-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3106.22 Pln | |
| Fluorochem | 5g | 10681.67 Pln |
| delivery time | 3-4 weeks |
|---|
2,5-diaminobenzoic acid;dihydrochloride (CAS 1158259-09-6) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: 2,5-diaminobenzoic acid;dihydrochloride. InChIKey: DYYLTSSEVZXCSY-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N2O2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 2,5-diaminobenzoic acid;dihydrochloride |
| InChIKey | DYYLTSSEVZXCSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)