CAS 618-56-4 appears in our catalog under these names: 3,5-Diaminobenzoic acid dihydrochloride, 98%, 3,5–Diaminobenzoic acid dihydrochloride, 3,5-Diaminobenzoic acid dihydrochloride, 3,5-Diaminobenzoic Acid Dihydrochloride, >98.0%(HPLC)(T), 3,5-Diaminobenzoic acid dihydrochloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 10g, 50g, 250g.
3,5-diaminobenzoic acid;dihydrochloride (CAS 618-56-4) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: 3,5-diaminobenzoic acid;dihydrochloride. InChIKey: IGPLRBRBTUNCRT-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N2O2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 3,5-diaminobenzoic acid;dihydrochloride |
| InChIKey | IGPLRBRBTUNCRT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)N)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)