Products 1188980-72-4
CAS 1188980-72-4 is the registry number for Methyl 2-oxo-1,2-dihydropyridine-3-carboximidoate dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Methyl 2-oxo-1H-pyridine-3-carboximidate;dihydrochloride (CAS 1188980-72-4) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: methyl 2-oxo-1H-pyridine-3-carboximidate;dihydrochloride. InChIKey: SLDAFAQTERMUAB-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N2O2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | methyl 2-oxo-1H-pyridine-3-carboximidate;dihydrochloride |
| InChIKey | SLDAFAQTERMUAB-UHFFFAOYSA-N |
| SMILES | COC(=N)C1=CC=CNC1=O.Cl.Cl |
Computed by PubChem (NCBI)