CAS 1803168-08-2 is the registry number for Vildagliptin Impurity 66. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-(2,2-dichloroacetyl)pyrrolidine-2-carboxamide (CAS 1803168-08-2) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: (2S)-1-(2,2-dichloroacetyl)pyrrolidine-2-carboxamide. InChIKey: MQQWYPYXEWSKJV-BYPYZUCNSA-N.
| Molecular formula | C7H10Cl2N2O2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | (2S)-1-(2,2-dichloroacetyl)pyrrolidine-2-carboxamide |
| InChIKey | MQQWYPYXEWSKJV-BYPYZUCNSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)C(Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)