CAS 1158259-09-6 appears in our catalog under these names: 2,5-Diaminobenzoic acid dihydrochloride, 96%, 2,5-Diaminobenzoic acid dihydrochloride, 98%+,RG, 98%+,RG, 2,5-Diaminobenzoic acid dihydrochloride, 98%+,RG. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g.
2,5-diaminobenzoic acid;dihydrochloride (CAS 1158259-09-6) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: 2,5-diaminobenzoic acid;dihydrochloride. InChIKey: DYYLTSSEVZXCSY-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N2O2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 2,5-diaminobenzoic acid;dihydrochloride |
| InChIKey | DYYLTSSEVZXCSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)