CAS 81864-15-5 appears in our catalog under these names: 1,3-Benzodioxole-5,6-diamine dihydrochloride, 95%, 1,2-Diamino-4,5-methylenedioxybenzene, Dihydrochloride, >95% (HPLC), 1,3–Benzodioxole–5,6–diamine (hydrochloride), 1,2-Diamino-4,5-methylenedioxybenzene dihydrochloride, 4,5-Methylenedioxy-1,2-phenylenediamine dihydrochloride, 90.00%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 50mg, 100mg, 10mg, 25mg, 0,25g, 0,1g.
1,3-benzodioxole-5,6-diamine;dihydrochloride (CAS 81864-15-5) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: 1,3-benzodioxole-5,6-diamine;dihydrochloride. InChIKey: YXEJRYIEFFUUID-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N2O2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 1,3-benzodioxole-5,6-diamine;dihydrochloride |
| InChIKey | YXEJRYIEFFUUID-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)N)N.Cl.Cl |
Computed by PubChem (NCBI)