cas: 1553716-42-9 — see every product listed under this CAS number, including other names
2,5-Dichloro-3-fluorobenzaldehyde (CAS 1553716-42-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631335-1G |
| cas | 1553716-42-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3345.71 Pln |
| delivery time | 3-4 weeks |
|---|
2,5-dichloro-3-fluorobenzaldehyde (CAS 1553716-42-9) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2,5-dichloro-3-fluorobenzaldehyde. InChIKey: WREBJBYYVPYMOB-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2,5-dichloro-3-fluorobenzaldehyde |
| InChIKey | WREBJBYYVPYMOB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)Cl)F)Cl |
Computed by PubChem (NCBI)