2,5-Dichloro-3-nitropyridine 98%
cas: 21427-62-3 — see every product listed under this CAS number, including other names
2,5-Dichloro-3-nitropyridine 98% (CAS 21427-62-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A566151-1g |
| cas | 21427-62-3 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 381.50 Pln | |
| Ambeed | 500g | 1610.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A566151 |
2,5-dichloro-3-nitropyridine (CAS 21427-62-3) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,5-dichloro-3-nitropyridine. InChIKey: OBUGJYJQJWMOQO-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,5-dichloro-3-nitropyridine |
| InChIKey | OBUGJYJQJWMOQO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)