cas: 886047-45-6 — see every product listed under this CAS number, including other names
2,5-Dichloro-6-methoxy-4-methylnicotinonitrile, 98%, 98% (CAS 886047-45-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119AYM-100mg |
| cas | 886047-45-6 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 530.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,5-dichloro-6-methoxy-4-methylpyridine-3-carbonitrile (CAS 886047-45-6) is a chemical compound with the molecular formula C8H6Cl2N2O and a molecular weight of 217.05 g/mol. IUPAC name: 2,5-dichloro-6-methoxy-4-methylpyridine-3-carbonitrile. InChIKey: FAJSGZKKDBVZAO-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 2,5-dichloro-6-methoxy-4-methylpyridine-3-carbonitrile |
| InChIKey | FAJSGZKKDBVZAO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1Cl)OC)Cl)C#N |
Computed by PubChem (NCBI)