CAS 337508-58-4 is the registry number for 1H-Benzimidazole-2-carbonyl chloride hydrochloride, 90%. Offered by: Combi-blocks. Available pack sizes: 500mg.
1H-benzimidazole-2-carbonyl chloride;hydrochloride (CAS 337508-58-4) is a chemical compound with the molecular formula C8H6Cl2N2O and a molecular weight of 217.05 g/mol. IUPAC name: 1H-benzimidazole-2-carbonyl chloride;hydrochloride. InChIKey: DJYWWBKRYDGFMZ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 1H-benzimidazole-2-carbonyl chloride;hydrochloride |
| InChIKey | DJYWWBKRYDGFMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C(=O)Cl.Cl |
Computed by PubChem (NCBI)