CAS 1361410-15-2 is the registry number for 2H-Pyrrolo[3,2-c]pyridin-2-one, 4,6-dichloro-1,3-dihydro-1-methyl-, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4,6-dichloro-1-methyl-3H-pyrrolo[3,2-c]pyridin-2-one (CAS 1361410-15-2) is a chemical compound with the molecular formula C8H6Cl2N2O and a molecular weight of 217.05 g/mol. IUPAC name: 4,6-dichloro-1-methyl-3H-pyrrolo[3,2-c]pyridin-2-one. InChIKey: YZPOAUAEDVPPLI-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 4,6-dichloro-1-methyl-3H-pyrrolo[3,2-c]pyridin-2-one |
| InChIKey | YZPOAUAEDVPPLI-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC2=C(N=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)