CAS 1000519-96-9 is the registry number for (2E)-3-(2,6-Dichloropyridin-3-yl)prop-2-enamide, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
(E)-3-(2,6-dichloro-3-pyridinyl)prop-2-enamide (CAS 1000519-96-9) is a chemical compound with the molecular formula C8H6Cl2N2O and a molecular weight of 217.05 g/mol. IUPAC name: (E)-3-(2,6-dichloro-3-pyridinyl)prop-2-enamide. InChIKey: IUANTXONUKBMJJ-DUXPYHPUSA-N.
| Molecular formula | C8H6Cl2N2O |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | (E)-3-(2,6-dichloro-3-pyridinyl)prop-2-enamide |
| InChIKey | IUANTXONUKBMJJ-DUXPYHPUSA-N |
| SMILES | C1=CC(=NC(=C1/C=C/C(=O)N)Cl)Cl |
Computed by PubChem (NCBI)