CAS 1935533-73-5 is the registry number for 5-Chloro-2-chloromethyl-benzooxazol-6-ylamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5-chloro-2-(chloromethyl)-1,3-benzoxazol-6-amine (CAS 1935533-73-5) is a chemical compound with the molecular formula C8H6Cl2N2O and a molecular weight of 217.05 g/mol. IUPAC name: 5-chloro-2-(chloromethyl)-1,3-benzoxazol-6-amine. InChIKey: YPJOWJWSDPPNJT-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 5-chloro-2-(chloromethyl)-1,3-benzoxazol-6-amine |
| InChIKey | YPJOWJWSDPPNJT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(=N2)CCl)Cl)N |
Computed by PubChem (NCBI)