CAS 1326813-70-0 is the registry number for 5,7-Dichloro-6-methylbenzo[d]oxazol-2-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-6-methyl-1,3-benzoxazol-2-amine (CAS 1326813-70-0) is a chemical compound with the molecular formula C8H6Cl2N2O and a molecular weight of 217.05 g/mol. IUPAC name: 5,7-dichloro-6-methyl-1,3-benzoxazol-2-amine. InChIKey: UUIBOAQAQMODPG-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 5,7-dichloro-6-methyl-1,3-benzoxazol-2-amine |
| InChIKey | UUIBOAQAQMODPG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1Cl)OC(=N2)N)Cl |
Computed by PubChem (NCBI)