2,5-Diethoxyaniline hydrochloride, 98%
cas: 1050208-16-6 — see every product listed under this CAS number, including other names
2,5-Diethoxyaniline hydrochloride, 98% (CAS 1050208-16-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1538015-100mg |
| cas | 1050208-16-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 1171.38 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 375.45 Pln | |
| BLDpharm | 5g | 1147.40 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1566.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2,5-diethoxyaniline;hydrochloride (CAS 1050208-16-6) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: 2,5-diethoxyaniline;hydrochloride. InChIKey: XNFYYAJVKOAGMV-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 2,5-diethoxyaniline;hydrochloride |
| InChIKey | XNFYYAJVKOAGMV-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)OCC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
2,5-diethoxyaniline;hydrochloride