cas: 120103-18-6 — see every product listed under this CAS number, including other names
2,5-Difluoro-4-nitrophenol 98% (CAS 120103-18-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A918728-250mg |
| cas | 120103-18-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1037.88 Pln | |
| Ambeed | 10g | 1621.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A918728 |
2,5-difluoro-4-nitrophenol (CAS 120103-18-6) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 2,5-difluoro-4-nitrophenol. InChIKey: WOQWWNJQZLYLMC-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 2,5-difluoro-4-nitrophenol |
| InChIKey | WOQWWNJQZLYLMC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)