CAS 147808-41-1 appears in our catalog under these names: 3,5-Difluoro-4-nitrophenol, 95%, 3,5–Difluoro–4–nitrophenol, 3,5-Difluoro-4-nitrophenol, 3,5-Difluoro-4-nitrophenol 95%, 3,5-Difluoro-4-nitrophenol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
3,5-difluoro-4-nitrophenol (CAS 147808-41-1) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 3,5-difluoro-4-nitrophenol. InChIKey: DDNBXAHODWXJKM-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 3,5-difluoro-4-nitrophenol |
| InChIKey | DDNBXAHODWXJKM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])F)O |
Computed by PubChem (NCBI)