CAS 123173-60-4 appears in our catalog under these names: 2,3–Difluoro–4–nitrophenol, 2,3-Difluoro-4-nitrophenol, 98%, 2,3-Difluoro-4-nitrophenol 95%, 2,3-Difluoro-4-nitrophenol, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 100mg, 250mg.
2,3-difluoro-4-nitrophenol (CAS 123173-60-4) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 2,3-difluoro-4-nitrophenol. InChIKey: FCCFXVJUDSQIMG-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 2,3-difluoro-4-nitrophenol |
| InChIKey | FCCFXVJUDSQIMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)F)O |
Computed by PubChem (NCBI)