CAS 113512-57-5 appears in our catalog under these names: 2,4-Difluoro-5-nitrophenol, 98% , 2,4-Difluoro-5-nitrophenol 97%, 2,4-Difluoro-5-nitrophenol, 95%. Offered by: Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 100g, 500g, 1000g.
2,4-difluoro-5-nitrophenol (CAS 113512-57-5) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 2,4-difluoro-5-nitrophenol. InChIKey: SMRYCTJAGPDVEH-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 2,4-difluoro-5-nitrophenol |
| InChIKey | SMRYCTJAGPDVEH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)