CAS 1119455-04-7 appears in our catalog under these names: 2,3-Difluoro-5-nitrophenol, 96%, 2,3-Difluoro-5-nitrophenol, 98%, 2,3–Difluoro–5–nitrophenol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 25g, 10g, 100mg, 250mg.
2,3-difluoro-5-nitrophenol (CAS 1119455-04-7) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 2,3-difluoro-5-nitrophenol. InChIKey: QEBOTENBPZWUEC-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 2,3-difluoro-5-nitrophenol |
| InChIKey | QEBOTENBPZWUEC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)