CAS 55346-97-9 appears in our catalog under these names: 4,5-Difluoro-2-nitrophenol, 97%, 4,5–Difluoro–2–nitrophenol, 4,5-Difluoro-2-nitrophenol 98%, 4,5-Difluoro-2-nitrophenol, 98%, 98%. Offered by: Fluorochem, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 250g, 500g, 1kg.
4,5-difluoro-2-nitrophenol (CAS 55346-97-9) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 4,5-difluoro-2-nitrophenol. InChIKey: KZODZOGGCQZLNF-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 4,5-difluoro-2-nitrophenol |
| InChIKey | KZODZOGGCQZLNF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)