cas: 306936-14-1 — see every product listed under this CAS number, including other names
2,5-Dimethyl-1-(2-thienylmethyl)-1H-pyrrole-3-carboxylic acid, 97% (CAS 306936-14-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | SP00291DA |
| cas | 306936-14-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 168.00 Pln | |
| Thermo Scientific | 5g | 565.08 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxylic acid (CAS 306936-14-1) is a chemical compound with the molecular formula C12H13NO2S and a molecular weight of 235.30 g/mol. IUPAC name: 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxylic acid. InChIKey: MYRBXKXOHIDTFU-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2S |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxylic acid |
| InChIKey | MYRBXKXOHIDTFU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1CC2=CC=CS2)C)C(=O)O |
Computed by PubChem (NCBI)