CAS 21224-20-4 is the registry number for 5-(1,3-Benzothiazol-2-yl)pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-(1,3-benzothiazol-2-yl)pentanoic acid (CAS 21224-20-4) is a chemical compound with the molecular formula C12H13NO2S and a molecular weight of 235.30 g/mol. IUPAC name: 5-(1,3-benzothiazol-2-yl)pentanoic acid. InChIKey: HHBVTXVPGVQCOD-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2S |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | 5-(1,3-benzothiazol-2-yl)pentanoic acid |
| InChIKey | HHBVTXVPGVQCOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)CCCCC(=O)O |
Computed by PubChem (NCBI)