Products 21224-20-4

CAS 21224-20-4 is the registry number for 5-(1,3-Benzothiazol-2-yl)pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(1,3-benzothiazol-2-yl)pentanoic acid (CAS 21224-20-4) is a chemical compound with the molecular formula C12H13NO2S and a molecular weight of 235.30 g/mol. IUPAC name: 5-(1,3-benzothiazol-2-yl)pentanoic acid. InChIKey: HHBVTXVPGVQCOD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO2S
Molecular weight235.30 g/mol
IUPAC name5-(1,3-benzothiazol-2-yl)pentanoic acid
InChIKeyHHBVTXVPGVQCOD-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)N=C(S2)CCCCC(=O)O

Computed by PubChem (NCBI)