Products 31894-56-1
CAS 31894-56-1 appears in our catalog under these names: Ethyl 5-methyl-3-(thiophen-2-yl)-1h-pyrrole-2-carboxylate, 95%, Ethyl 5–methyl–3–(thiophen–2–yl)–1H–pyrrole–2–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
Ethyl 5-methyl-3-thiophen-2-yl-1H-pyrrole-2-carboxylate (CAS 31894-56-1) is a chemical compound with the molecular formula C12H13NO2S and a molecular weight of 235.30 g/mol. IUPAC name: ethyl 5-methyl-3-thiophen-2-yl-1H-pyrrole-2-carboxylate. InChIKey: TVPDFOTUZNQYOE-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2S |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | ethyl 5-methyl-3-thiophen-2-yl-1H-pyrrole-2-carboxylate |
| InChIKey | TVPDFOTUZNQYOE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(N1)C)C2=CC=CS2 |
Computed by PubChem (NCBI)