CAS 256950-42-2 appears in our catalog under these names: 4-(3,4-Dimethoxyphenyl)-2-methyl-1,3-thiazole, 4-(3,4-Dimethoxy-phenyl)-2-methyl-thiazole, 95%, 4-(3,4-Dimethoxyphenyl)-2-methyl-1,3-thiazole, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 10g, 250mg, 1g, 100mg.
4-(3,4-dimethoxyphenyl)-2-methyl-1,3-thiazole (CAS 256950-42-2) is a chemical compound with the molecular formula C12H13NO2S and a molecular weight of 235.30 g/mol. IUPAC name: 4-(3,4-dimethoxyphenyl)-2-methyl-1,3-thiazole. InChIKey: VVVWTJUBHPSWNO-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2S |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | 4-(3,4-dimethoxyphenyl)-2-methyl-1,3-thiazole |
| InChIKey | VVVWTJUBHPSWNO-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)