CAS 478077-85-9 is the registry number for Methyl 2-(2,5-dimethyl-1h-pyrrol-1-yl)thiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carboxylate (CAS 478077-85-9) is a chemical compound with the molecular formula C12H13NO2S and a molecular weight of 235.30 g/mol. IUPAC name: methyl 2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carboxylate. InChIKey: IHRKHWITDNTYIN-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2S |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | methyl 2-(2,5-dimethylpyrrol-1-yl)thiophene-3-carboxylate |
| InChIKey | IHRKHWITDNTYIN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=C(C=CS2)C(=O)OC)C |
Computed by PubChem (NCBI)