CAS 306936-14-1 appears in our catalog under these names: 2,5-Dimethyl-1-(2-thienylmethyl)-1h-pyrrole-3-carboxylic acid, 95%, 2,5-Dimethyl-1-(2-thienylmethyl)pyrrole-3-carboxylic acid, 2,5-Dimethyl-1-(2-thienylmethyl)-1H-pyrrole-3-carboxylic acid, 97% . Offered by: Combi-blocks, Biosynth, Thermo Scientific. Available pack sizes: 1g, 5g, 10g.
2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxylic acid (CAS 306936-14-1) is a chemical compound with the molecular formula C12H13NO2S and a molecular weight of 235.30 g/mol. IUPAC name: 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxylic acid. InChIKey: MYRBXKXOHIDTFU-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2S |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | 2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxylic acid |
| InChIKey | MYRBXKXOHIDTFU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1CC2=CC=CS2)C)C(=O)O |
Computed by PubChem (NCBI)