CAS 200197-04-2 is the registry number for 2,5-Dioxopyrrolidin-1-yl (4-carbamoylphenyl)carbamate, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(2,5-dioxopyrrolidin-1-yl) N-(4-carbamoylphenyl)carbamate (CAS 200197-04-2) is a chemical compound with the molecular formula C12H11N3O5 and a molecular weight of 277.23 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) N-(4-carbamoylphenyl)carbamate. InChIKey: VXXQVFDQGVJZNL-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O5 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) N-(4-carbamoylphenyl)carbamate |
| InChIKey | VXXQVFDQGVJZNL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)NC2=CC=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)