CAS 1119391-67-1 is the registry number for 2-nitro-3-((3-nitrophenyl)amino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-nitro-3-(3-nitroanilino)cyclohex-2-en-1-one (CAS 1119391-67-1) is a chemical compound with the molecular formula C12H11N3O5 and a molecular weight of 277.23 g/mol. IUPAC name: 2-nitro-3-(3-nitroanilino)cyclohex-2-en-1-one. InChIKey: ZFJUFOOKXWBXSE-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O5 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | 2-nitro-3-(3-nitroanilino)cyclohex-2-en-1-one |
| InChIKey | ZFJUFOOKXWBXSE-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C(=O)C1)[N+](=O)[O-])NC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)