CAS 146698-89-7 is the registry number for Entacapone Impurity 69. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N-ethylprop-2-enamide (CAS 146698-89-7) is a chemical compound with the molecular formula C12H11N3O5 and a molecular weight of 277.23 g/mol. IUPAC name: (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N-ethylprop-2-enamide. InChIKey: HTYFXWJKHSXXFC-FPYGCLRLSA-N.
| Molecular formula | C12H11N3O5 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)-N-ethylprop-2-enamide |
| InChIKey | HTYFXWJKHSXXFC-FPYGCLRLSA-N |
| SMILES | CCNC(=O)/C(=C/C1=CC(=C(C(=C1)O)O)[N+](=O)[O-])/C#N |
Computed by PubChem (NCBI)