Products 956204-53-8

CAS 956204-53-8 is the registry number for 4-Methoxy-3-((4-nitro-1H-pyrazol-1-yl)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]benzoic acid (CAS 956204-53-8) is a chemical compound with the molecular formula C12H11N3O5 and a molecular weight of 277.23 g/mol. IUPAC name: 4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]benzoic acid. InChIKey: SMTTWBNEGXXXDN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N3O5
Molecular weight277.23 g/mol
IUPAC name4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]benzoic acid
InChIKeySMTTWBNEGXXXDN-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)O)CN2C=C(C=N2)[N+](=O)[O-]

Computed by PubChem (NCBI)