Products 26502-55-6
CAS 26502-55-6 is the registry number for Ethyl 4-hydroxy-1-(4-nitrophenyl)-1h-pyrazole-3-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Ethyl 4-hydroxy-1-(4-nitrophenyl)pyrazole-3-carboxylate (CAS 26502-55-6) is a chemical compound with the molecular formula C12H11N3O5 and a molecular weight of 277.23 g/mol. IUPAC name: ethyl 4-hydroxy-1-(4-nitrophenyl)pyrazole-3-carboxylate. InChIKey: YCORTVKYQADVAR-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O5 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | ethyl 4-hydroxy-1-(4-nitrophenyl)pyrazole-3-carboxylate |
| InChIKey | YCORTVKYQADVAR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C=C1O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)