CAS 92574-76-0 is the registry number for 2-((Benzyloxy)methyl)-4-hydroxy-5-nitropyridazin-3(2H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-nitro-2-(phenylmethoxymethyl)-1H-pyridazine-3,4-dione (CAS 92574-76-0) is a chemical compound with the molecular formula C12H11N3O5 and a molecular weight of 277.23 g/mol. IUPAC name: 5-nitro-2-(phenylmethoxymethyl)-1H-pyridazine-3,4-dione. InChIKey: XJBQPEABVUARQQ-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O5 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | 5-nitro-2-(phenylmethoxymethyl)-1H-pyridazine-3,4-dione |
| InChIKey | XJBQPEABVUARQQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCN2C(=O)C(=O)C(=CN2)[N+](=O)[O-] |
Computed by PubChem (NCBI)