2,5-Pyrazinedicarboxylic acid 97%
cas: 122-05-4 — see every product listed under this CAS number, including other names
2,5-Pyrazinedicarboxylic acid 97% (CAS 122-05-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A344554-1g |
| cas | 122-05-4 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 236.88 Pln | |
| Ambeed | 100g | 720.81 Pln | |
| Ambeed | 500g | 3312.94 Pln | |
| Ambeed | 1000g | 6283.31 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A344554 |
Pyrazine-2,5-dicarboxylic acid (CAS 122-05-4) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyrazine-2,5-dicarboxylic acid. InChIKey: GMIOYJQLNFNGPR-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyrazine-2,5-dicarboxylic acid |
| InChIKey | GMIOYJQLNFNGPR-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)