cas: 122-05-4 — see every product listed under this CAS number, including other names
Pyrazine-2,5-dicarboxylic Acid, >98.0%(HPLC)(T) (CAS 122-05-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P2932-5G |
| cas | 122-05-4 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 270.78 Pln | |
| TCI | 25g | 900.19 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
Pyrazine-2,5-dicarboxylic acid (CAS 122-05-4) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyrazine-2,5-dicarboxylic acid. InChIKey: GMIOYJQLNFNGPR-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyrazine-2,5-dicarboxylic acid |
| InChIKey | GMIOYJQLNFNGPR-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)