cas: 122-05-4 — see every product listed under this CAS number, including other names
2,5-Pyrazinedicarboxylic acid hydrate, 97% (CAS 122-05-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 292320010 |
| cas | 122-05-4 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 516.72 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
Pyrazine-2,5-dicarboxylic acid (CAS 122-05-4) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyrazine-2,5-dicarboxylic acid. InChIKey: GMIOYJQLNFNGPR-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyrazine-2,5-dicarboxylic acid |
| InChIKey | GMIOYJQLNFNGPR-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)