Products 853748-46-6
CAS 853748-46-6 appears in our catalog under these names: 2,6-Bis(3-methyl-1H-pyrazol-1-yl)pyridine, 95%, 95%, 2,6-Bis(3-methyl-1H-pyrazol-1-yl)pyridine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,6-bis(3-methylpyrazol-1-yl)pyridine (CAS 853748-46-6) is a chemical compound with the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. IUPAC name: 2,6-bis(3-methylpyrazol-1-yl)pyridine. InChIKey: RAIXXDUNEZBGDR-UHFFFAOYSA-N.
| Molecular formula | C13H13N5 |
|---|---|
| Molecular weight | 239.28 g/mol |
| IUPAC name | 2,6-bis(3-methylpyrazol-1-yl)pyridine |
| InChIKey | RAIXXDUNEZBGDR-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1)C2=NC(=CC=C2)N3C=CC(=N3)C |
Computed by PubChem (NCBI)