CAS 1770824-08-2 is the registry number for 5–(4–aminophenyl)–7–methyl–7H–pyrrolo(2,3–d)pyrimidin–4–amine. Offered by: GLPBio. Available pack sizes: 100mg.
5-(4-aminophenyl)-7-methylpyrrolo[2,3-d]pyrimidin-4-amine (CAS 1770824-08-2) is a chemical compound with the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. IUPAC name: 5-(4-aminophenyl)-7-methylpyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: BAEKRMUFCBZPQL-UHFFFAOYSA-N.
| Molecular formula | C13H13N5 |
|---|---|
| Molecular weight | 239.28 g/mol |
| IUPAC name | 5-(4-aminophenyl)-7-methylpyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | BAEKRMUFCBZPQL-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C(N=CN=C21)N)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)