Products 696601-78-2
CAS 696601-78-2 is the registry number for 2-amino-1-(1-aza-2-(4-(dimethylamino)phenyl)vinyl)ethene-1,2-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg.
(Z)-2-amino-3-[[4-(dimethylamino)phenyl]methylideneamino]but-2-enedinitrile (CAS 696601-78-2) is a chemical compound with the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. IUPAC name: (Z)-2-amino-3-[[4-(dimethylamino)phenyl]methylideneamino]but-2-enedinitrile. InChIKey: QPBXVINHXQCKKI-KXBPZSEOSA-N.
| Molecular formula | C13H13N5 |
|---|---|
| Molecular weight | 239.28 g/mol |
| IUPAC name | (Z)-2-amino-3-[[4-(dimethylamino)phenyl]methylideneamino]but-2-enedinitrile |
| InChIKey | QPBXVINHXQCKKI-KXBPZSEOSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C=N/C(=C(/C#N)\N)/C#N |
Computed by PubChem (NCBI)