CAS 351226-56-7 is the registry number for 5-(5-Amino-1H-benzo[d]imidazol-2-yl)benzene-1,3-diamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(6-amino-1H-benzimidazol-2-yl)benzene-1,3-diamine (CAS 351226-56-7) is a chemical compound with the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. IUPAC name: 5-(6-amino-1H-benzimidazol-2-yl)benzene-1,3-diamine. InChIKey: NOTURRYDNKQNKF-UHFFFAOYSA-N.
| Molecular formula | C13H13N5 |
|---|---|
| Molecular weight | 239.28 g/mol |
| IUPAC name | 5-(6-amino-1H-benzimidazol-2-yl)benzene-1,3-diamine |
| InChIKey | NOTURRYDNKQNKF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)NC(=N2)C3=CC(=CC(=C3)N)N |
Computed by PubChem (NCBI)